C9H13NO3 — CID 15177633
(4R,5R)-3-acetyl-4-ethenyl-5-ethyl-1,3-oxazolidin-2-one (PubChem CID 15177633) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (4R,5R)-3-acetyl-4-ethenyl-5-ethyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-3-acetyl-4-ethenyl-5-ethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15177633 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (4R,5R)-3-acetyl-4-ethenyl-5-ethyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1[C@@H](CC)OC(=O)N1C(C)=O |
| InChI | InChI=1S/C9H13NO3/c1-4-7-8(5-2)13-9(12)10(7)6(3)11/h4,7-8H,1,5H2,2-3H3/t7-,8-/m1/s1 |
| InChIKey | WGDWHGCZBCJEHG-HTQZYQBOSA-N |
| XLogP | 1.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|