C9H15NO2 — CID 22891809
3-butyl-4-ethenyl-1,3-oxazolidin-2-one (PubChem CID 22891809) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 3-butyl-4-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-butyl-4-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22891809 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 3-butyl-4-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=CC1COC(=O)N1CCCC |
| InChI | InChI=1S/C9H15NO2/c1-3-5-6-10-8(4-2)7-12-9(10)11/h4,8H,2-3,5-7H2,1H3 |
| InChIKey | FZLHSOUXFOTLDH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|