C9H11NO2 — CID 135080253
3-hexa-1,2,5-trien-3-yl-1,3-oxazolidin-2-one (PubChem CID 135080253) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-hexa-1,2,5-trien-3-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-hexa-1,2,5-trien-3-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135080253 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-hexa-1,2,5-trien-3-yl-1,3-oxazolidin-2-one |
| SMILES | C=C=C(CC=C)N1CCOC1=O |
| InChI | InChI=1S/C9H11NO2/c1-3-5-8(4-2)10-6-7-12-9(10)11/h3H,1-2,5-7H2 |
| InChIKey | WGGIQCBFZYRWOX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|