C7H9NO3 — CID 23405610
3-acetyl-4-ethenyl-1,3-oxazolidin-2-one (PubChem CID 23405610) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 3-acetyl-4-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-acetyl-4-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23405610 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 3-acetyl-4-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=CC1COC(=O)N1C(C)=O |
| InChI | InChI=1S/C7H9NO3/c1-3-6-4-11-7(10)8(6)5(2)9/h3,6H,1,4H2,2H3 |
| InChIKey | SDIRXBOXHFDZGK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|