C14H23F2NO2 — CID 151785741
ethyl 3-[(2S)-1-tert-butyl-5,5-difluoropiperidin-2-yl]prop-2-enoate (PubChem CID 151785741) has the molecular formula C14H23F2NO2 and a molecular weight of 275.34 g/mol. Its IUPAC name is ethyl 3-[(2S)-1-tert-butyl-5,5-difluoropiperidin-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[(2S)-1-tert-butyl-5,5-difluoropiperidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 151785741 |
| Molecular Formula | C14H23F2NO2 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | ethyl 3-[(2S)-1-tert-butyl-5,5-difluoropiperidin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=C[C@@H]1CCC(F)(F)CN1C(C)(C)C |
| InChI | InChI=1S/C14H23F2NO2/c1-5-19-12(18)7-6-11-8-9-14(15,16)10-17(11)13(2,3)4/h6-7,11H,5,8-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | RVOHUCSDMQFRPL-LLVKDONJSA-N |
| XLogP | 3.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|