C12H16Cl2N6O — CID 151785816
2-[[2,6-dichloro-4-(propylamino)pyrimido[5,4-d]pyrimidin-8-yl]methylamino]ethanol (PubChem CID 151785816) has the molecular formula C12H16Cl2N6O and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-(propylamino)pyrimido[5,4-d]pyrimidin-8-yl]methylamino]ethanol.
| Compound Name | 2-[[2,6-dichloro-4-(propylamino)pyrimido[5,4-d]pyrimidin-8-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 151785816 |
| Molecular Formula | C12H16Cl2N6O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[[2,6-dichloro-4-(propylamino)pyrimido[5,4-d]pyrimidin-8-yl]methylamino]ethanol |
| SMILES | CCCNc1nc(Cl)nc2c(CNCCO)nc(Cl)nc12 |
| InChI | InChI=1S/C12H16Cl2N6O/c1-2-3-16-10-9-8(18-12(14)20-10)7(6-15-4-5-21)17-11(13)19-9/h15,21H,2-6H2,1H3,(H,16,18,20) |
| InChIKey | RVONUHGKMVKWOL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|