C7H9NO2 — CID 15179114
1,4-dimethyl-3H-pyridine-2,6-dione (PubChem CID 15179114) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 1,4-dimethyl-3H-pyridine-2,6-dione.
| Compound Name | 1,4-dimethyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 15179114 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 1,4-dimethyl-3H-pyridine-2,6-dione |
| SMILES | CC1=CC(=O)N(C)C(=O)C1 |
| InChI | InChI=1S/C7H9NO2/c1-5-3-6(9)8(2)7(10)4-5/h3H,4H2,1-2H3 |
| InChIKey | BGZKFUWEJKUXSM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|