C16H29NOSi — CID 15180237
1-tri(propan-2-yl)silyloxycyclohex-2-ene-1-carbonitrile (PubChem CID 15180237) has the molecular formula C16H29NOSi and a molecular weight of 279.50 g/mol. Its IUPAC name is 1-tri(propan-2-yl)silyloxycyclohex-2-ene-1-carbonitrile.
| Compound Name | 1-tri(propan-2-yl)silyloxycyclohex-2-ene-1-carbonitrile |
|---|---|
| PubChem CID | 15180237 |
| Molecular Formula | C16H29NOSi |
| Molecular Weight | 279.50 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-tri(propan-2-yl)silyloxycyclohex-2-ene-1-carbonitrile |
| SMILES | CC(C)[Si](OC1(C#N)C=CCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H29NOSi/c1-13(2)19(14(3)4,15(5)6)18-16(12-17)10-8-7-9-11-16/h8,10,13-15H,7,9,11H2,1-6H3 |
| InChIKey | MHAYBMQOZACEMX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|