C24H48O3 — CID 151813134
5-(3-but-1-enoxypropyl)-4,4-diethoxytridecane (PubChem CID 151813134) has the molecular formula C24H48O3 and a molecular weight of 384.65 g/mol. Its IUPAC name is 5-(3-but-1-enoxypropyl)-4,4-diethoxytridecane.
| Compound Name | 5-(3-but-1-enoxypropyl)-4,4-diethoxytridecane |
|---|---|
| PubChem CID | 151813134 |
| Molecular Formula | C24H48O3 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.36 |
| IUPAC Name | 5-(3-but-1-enoxypropyl)-4,4-diethoxytridecane |
| SMILES | CCC=COCCCC(CCCCCCCC)C(CCC)(OCC)OCC |
| InChI | InChI=1S/C24H48O3/c1-6-11-13-14-15-16-18-23(19-17-22-25-21-12-7-2)24(20-8-3,26-9-4)27-10-5/h12,21,23H,6-11,13-20,22H2,1-5H3 |
| InChIKey | SBAPUMAEEMWTNV-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|