C10H15N2OP — CID 151818448
1,1-diaminobutan-2-ylidene-oxido-phenylphosphanium (PubChem CID 151818448) has the molecular formula C10H15N2OP and a molecular weight of 210.22 g/mol. Its IUPAC name is 1,1-diaminobutan-2-ylidene-oxido-phenylphosphanium.
| Compound Name | 1,1-diaminobutan-2-ylidene-oxido-phenylphosphanium |
|---|---|
| PubChem CID | 151818448 |
| Molecular Formula | C10H15N2OP |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1,1-diaminobutan-2-ylidene-oxido-phenylphosphanium |
| SMILES | CCC(C(N)N)=[P+]([O-])c1ccccc1 |
| InChI | InChI=1S/C10H15N2OP/c1-2-9(10(11)12)14(13)8-6-4-3-5-7-8/h3-7,10H,2,11-12H2,1H3 |
| InChIKey | SCCVAQUYZSSFHX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|