C19H15F4NO3 — CID 151854639
ethyl 2-(4-fluorobenzenecarboximidoyl)-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoate (PubChem CID 151854639) has the molecular formula C19H15F4NO3 and a molecular weight of 381.33 g/mol. Its IUPAC name is ethyl 2-(4-fluorobenzenecarboximidoyl)-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoate.
| Compound Name | ethyl 2-(4-fluorobenzenecarboximidoyl)-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 151854639 |
| Molecular Formula | C19H15F4NO3 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | ethyl 2-(4-fluorobenzenecarboximidoyl)-3-hydroxy-3-(3,4,6-trifluoro-2-methylphenyl)prop-2-enoate |
| SMILES | [H]/N=C(/C(C(=O)OCC)=C(O)c1c(F)cc(F)c(F)c1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15F4NO3/c1-3-27-19(26)15(17(24)10-4-6-11(20)7-5-10)18(25)14-9(2)16(23)13(22)8-12(14)21/h4-8,24-25H,3H2,1-2H3/b18-15?,24-17+ |
| InChIKey | NWPSYBLPFHQUAS-ASISVDOGSA-N |
| XLogP | 4.45 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|