C24H30N4O3S — CID 151854642
3-[4-[2-(1,3,3-trimethoxy-2H-indol-5-yl)ethyl]piperazin-1-yl]-1,2-benzothiazole (PubChem CID 151854642) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is 3-[4-[2-(1,3,3-trimethoxy-2H-indol-5-yl)ethyl]piperazin-1-yl]-1,2-benzothiazole.
| Compound Name | 3-[4-[2-(1,3,3-trimethoxy-2H-indol-5-yl)ethyl]piperazin-1-yl]-1,2-benzothiazole |
|---|---|
| PubChem CID | 151854642 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 3-[4-[2-(1,3,3-trimethoxy-2H-indol-5-yl)ethyl]piperazin-1-yl]-1,2-benzothiazole |
| SMILES | CON1CC(OC)(OC)c2cc(CCN3CCN(c4nsc5ccccc45)CC3)ccc21 |
| InChI | InChI=1S/C24H30N4O3S/c1-29-24(30-2)17-28(31-3)21-9-8-18(16-20(21)24)10-11-26-12-14-27(15-13-26)23-19-6-4-5-7-22(19)32-25-23/h4-9,16H,10-15,17H2,1-3H3 |
| InChIKey | SJKPXLALEPOILN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|