C23H25FN4OS — CID 139649208
[5-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-1H-indol-7-yl] hypofluorite (PubChem CID 139649208) has the molecular formula C23H25FN4OS and a molecular weight of 424.55 g/mol. Its IUPAC name is [5-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-1H-indol-7-yl] hypofluorite.
| Compound Name | [5-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-1H-indol-7-yl] hypofluorite |
|---|---|
| PubChem CID | 139649208 |
| Molecular Formula | C23H25FN4OS |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [5-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-1H-indol-7-yl] hypofluorite |
| SMILES | FOc1cc(CCCCN2CCN(c3nsc4ccccc34)CC2)cc2cc[nH]c12 |
| InChI | InChI=1S/C23H25FN4OS/c24-29-20-16-17(15-18-8-9-25-22(18)20)5-3-4-10-27-11-13-28(14-12-27)23-19-6-1-2-7-21(19)30-26-23/h1-2,6-9,15-16,25H,3-5,10-14H2 |
| InChIKey | HKYPDCPHOJCNLL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|