C19H33N — CID 151860733
1-decyl-3,4,4a,5-tetrahydro-2H-quinoline (PubChem CID 151860733) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is 1-decyl-3,4,4a,5-tetrahydro-2H-quinoline.
| Compound Name | 1-decyl-3,4,4a,5-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 151860733 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 1-decyl-3,4,4a,5-tetrahydro-2H-quinoline |
| SMILES | CCCCCCCCCCN1CCCC2CC=CC=C21 |
| InChI | InChI=1S/C19H33N/c1-2-3-4-5-6-7-8-11-16-20-17-12-14-18-13-9-10-15-19(18)20/h9-10,15,18H,2-8,11-14,16-17H2,1H3 |
| InChIKey | SKQVLXCMIRXDFK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|