C22H20N2O2 — CID 151863125
2-[(9-butylcarbazol-3-yl)amino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 151863125) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[(9-butylcarbazol-3-yl)amino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(9-butylcarbazol-3-yl)amino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 151863125 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[(9-butylcarbazol-3-yl)amino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCn1c2ccccc2c2cc(NC3=CC(=O)C=CC3=O)ccc21 |
| InChI | InChI=1S/C22H20N2O2/c1-2-3-12-24-20-7-5-4-6-17(20)18-13-15(8-10-21(18)24)23-19-14-16(25)9-11-22(19)26/h4-11,13-14,23H,2-3,12H2,1H3 |
| InChIKey | SLCVNDQWDOCZOO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|