C25H19F2N3O3S — CID 151880134
2-(5-amino-2-trityl-1,3-thiazol-4-yl)-2-(difluoromethoxyimino)acetic acid (PubChem CID 151880134) has the molecular formula C25H19F2N3O3S and a molecular weight of 479.51 g/mol. Its IUPAC name is 2-(5-amino-2-trityl-1,3-thiazol-4-yl)-2-(difluoromethoxyimino)acetic acid.
| Compound Name | 2-(5-amino-2-trityl-1,3-thiazol-4-yl)-2-(difluoromethoxyimino)acetic acid |
|---|---|
| PubChem CID | 151880134 |
| Molecular Formula | C25H19F2N3O3S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-(5-amino-2-trityl-1,3-thiazol-4-yl)-2-(difluoromethoxyimino)acetic acid |
| SMILES | Nc1sc(C(c2ccccc2)(c2ccccc2)c2ccccc2)nc1C(=NOC(F)F)C(=O)O |
| InChI | InChI=1S/C25H19F2N3O3S/c26-24(27)33-30-20(22(31)32)19-21(28)34-23(29-19)25(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,24H,28H2,(H,31,32) |
| InChIKey | SONMZALDOWQYBG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|