About [azido(nitro)amino] cyanate
[azido(nitro)amino] cyanate (PubChem CID 151884984) has the molecular formula CN6O3
and a molecular weight of 144.05 g/mol. Its IUPAC name is [azido(nitro)amino] cyanate.
Molecular Properties
| Compound Name | [azido(nitro)amino] cyanate |
| PubChem CID | 151884984 |
| Molecular Formula | CN6O3 |
| Molecular Weight | 144.05 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | [azido(nitro)amino] cyanate |
| SMILES | N#CON(N=[N+]=[N-])[N+](=O)[O-] |
| InChI | InChI=1S/CN6O3/c2-1-10-6(5-4-3)7(8)9 |
| InChIKey | SPMYZFWIQMPXEF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 128.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.05 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze [azido(nitro)amino] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [azido(nitro)amino] cyanate?
The IUPAC name of [azido(nitro)amino] cyanate (CID 151884984) is [azido(nitro)amino] cyanate.
What is the SMILES notation for [azido(nitro)amino] cyanate?
The canonical SMILES for [azido(nitro)amino] cyanate is N#CON(N=[N+]=[N-])[N+](=O)[O-].
What is the InChIKey of [azido(nitro)amino] cyanate?
The InChIKey is SPMYZFWIQMPXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/CN6O3/c2-1-10-6(5-4-3)7(8)9.
What are the key properties of [azido(nitro)amino] cyanate?
[azido(nitro)amino] cyanate has a molecular weight of 144.05 g/mol, XLogP of 0.12, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [azido(nitro)amino] cyanate is sourced from PubChem (CID 151884984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).