C7H8F3NO3 — CID 151886577
(5,5,5-trifluoro-4-hydroxy-4-methylpent-2-ynyl)carbamic acid (PubChem CID 151886577) has the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. Its IUPAC name is (5,5,5-trifluoro-4-hydroxy-4-methylpent-2-ynyl)carbamic acid.
| Compound Name | (5,5,5-trifluoro-4-hydroxy-4-methylpent-2-ynyl)carbamic acid |
|---|---|
| PubChem CID | 151886577 |
| Molecular Formula | C7H8F3NO3 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (5,5,5-trifluoro-4-hydroxy-4-methylpent-2-ynyl)carbamic acid |
| SMILES | CC(O)(C#CCNC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO3/c1-6(14,7(8,9)10)3-2-4-11-5(12)13/h11,14H,4H2,1H3,(H,12,13) |
| InChIKey | SPVJTPRVVQZNMQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|