C9H18N2O4 — CID 90470587
[2-[(carboxyamino)methyl]-3,3-dimethylbutyl]carbamic acid (PubChem CID 90470587) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is [2-[(carboxyamino)methyl]-3,3-dimethylbutyl]carbamic acid.
| Compound Name | [2-[(carboxyamino)methyl]-3,3-dimethylbutyl]carbamic acid |
|---|---|
| PubChem CID | 90470587 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [2-[(carboxyamino)methyl]-3,3-dimethylbutyl]carbamic acid |
| SMILES | CC(C)(C)C(CNC(=O)O)CNC(=O)O |
| InChI | InChI=1S/C9H18N2O4/c1-9(2,3)6(4-10-7(12)13)5-11-8(14)15/h6,10-11H,4-5H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | DKXGYFVZQPEBST-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |