C19H13NO4 — CID 151906058
4,5-diphenylpyridine-2,3-dicarboxylic acid (PubChem CID 151906058) has the molecular formula C19H13NO4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 4,5-diphenylpyridine-2,3-dicarboxylic acid.
| Compound Name | 4,5-diphenylpyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151906058 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4,5-diphenylpyridine-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1ncc(-c2ccccc2)c(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C19H13NO4/c21-18(22)16-15(13-9-5-2-6-10-13)14(11-20-17(16)19(23)24)12-7-3-1-4-8-12/h1-11H,(H,21,22)(H,23,24) |
| InChIKey | STTLUBRSDSLCKJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |