C11H27NSi — CID 151918485
N-[2,2-dimethylpropyl(ethyl)silyl]-N-ethylethanamine (PubChem CID 151918485) has the molecular formula C11H27NSi and a molecular weight of 201.43 g/mol. Its IUPAC name is N-[2,2-dimethylpropyl(ethyl)silyl]-N-ethylethanamine.
| Compound Name | N-[2,2-dimethylpropyl(ethyl)silyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 151918485 |
| Molecular Formula | C11H27NSi |
| Molecular Weight | 201.43 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | N-[2,2-dimethylpropyl(ethyl)silyl]-N-ethylethanamine |
| SMILES | CCN(CC)[SiH](CC)CC(C)(C)C |
| InChI | InChI=1S/C11H27NSi/c1-7-12(8-2)13(9-3)10-11(4,5)6/h13H,7-10H2,1-6H3 |
| InChIKey | SWGKPTNMCQVSKW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|