C11H12BrF6N3O — CID 151921483
6-bromo-2-N-(3,3,3-trifluoro-2-methoxy-2-methylpropyl)-5-(trifluoromethyl)pyridine-2,3-diamine (PubChem CID 151921483) has the molecular formula C11H12BrF6N3O and a molecular weight of 396.13 g/mol. Its IUPAC name is 6-bromo-2-N-(3,3,3-trifluoro-2-methoxy-2-methylpropyl)-5-(trifluoromethyl)pyridine-2,3-diamine.
| Compound Name | 6-bromo-2-N-(3,3,3-trifluoro-2-methoxy-2-methylpropyl)-5-(trifluoromethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 151921483 |
| Molecular Formula | C11H12BrF6N3O |
| Molecular Weight | 396.13 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 6-bromo-2-N-(3,3,3-trifluoro-2-methoxy-2-methylpropyl)-5-(trifluoromethyl)pyridine-2,3-diamine |
| SMILES | COC(C)(CNc1nc(Br)c(C(F)(F)F)cc1N)C(F)(F)F |
| InChI | InChI=1S/C11H12BrF6N3O/c1-9(22-2,11(16,17)18)4-20-8-6(19)3-5(7(12)21-8)10(13,14)15/h3H,4,19H2,1-2H3,(H,20,21) |
| InChIKey | SWVVKKCOLFMCFL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|