C12H13BrF3N3O3 — CID 118387237
[3-amino-6-bromo-5-(trifluoromethyl)-2-pyridinyl] N-(oxolan-2-ylmethyl)carbamate (PubChem CID 118387237) has the molecular formula C12H13BrF3N3O3 and a molecular weight of 384.15 g/mol. Its IUPAC name is [3-amino-6-bromo-5-(trifluoromethyl)-2-pyridinyl] N-(oxolan-2-ylmethyl)carbamate.
| Compound Name | [3-amino-6-bromo-5-(trifluoromethyl)-2-pyridinyl] N-(oxolan-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 118387237 |
| Molecular Formula | C12H13BrF3N3O3 |
| Molecular Weight | 384.15 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | [3-amino-6-bromo-5-(trifluoromethyl)-2-pyridinyl] N-(oxolan-2-ylmethyl)carbamate |
| SMILES | Nc1cc(C(F)(F)F)c(Br)nc1OC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C12H13BrF3N3O3/c13-9-7(12(14,15)16)4-8(17)10(19-9)22-11(20)18-5-6-2-1-3-21-6/h4,6H,1-3,5,17H2,(H,18,20) |
| InChIKey | KETQCSRVLIVIEE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.15 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|