C22H19F3N2O2S — CID 4080455
N-(oxolan-2-ylmethyl)-2-[2-(trifluoromethyl)phenyl]sulfanylquinoline-4-carboxamide (PubChem CID 4080455) has the molecular formula C22H19F3N2O2S and a molecular weight of 432.47 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-[2-(trifluoromethyl)phenyl]sulfanylquinoline-4-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-[2-(trifluoromethyl)phenyl]sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4080455 |
| Molecular Formula | C22H19F3N2O2S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-[2-(trifluoromethyl)phenyl]sulfanylquinoline-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc(Sc2ccccc2C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C22H19F3N2O2S/c23-22(24,25)17-8-2-4-10-19(17)30-20-12-16(15-7-1-3-9-18(15)27-20)21(28)26-13-14-6-5-11-29-14/h1-4,7-10,12,14H,5-6,11,13H2,(H,26,28) |
| InChIKey | SYWOSDULAUBPNU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |