C24H25F3N3O2S+ — CID 4080464
N-(3-morpholin-4-ium-4-ylpropyl)-2-[2-(trifluoromethyl)phenyl]sulfanylquinoline-4-carboxamide (PubChem CID 4080464) has the molecular formula C24H25F3N3O2S+ and a molecular weight of 476.54 g/mol. Its IUPAC name is N-(3-morpholin-4-ium-4-ylpropyl)-2-[2-(trifluoromethyl)phenyl]sulfanylquinoline-4-carboxamide.
| Compound Name | N-(3-morpholin-4-ium-4-ylpropyl)-2-[2-(trifluoromethyl)phenyl]sulfanylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4080464 |
| Molecular Formula | C24H25F3N3O2S+ |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-(3-morpholin-4-ium-4-ylpropyl)-2-[2-(trifluoromethyl)phenyl]sulfanylquinoline-4-carboxamide |
| SMILES | O=C(NCCC[NH+]1CCOCC1)c1cc(Sc2ccccc2C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C24H24F3N3O2S/c25-24(26,27)19-7-2-4-9-21(19)33-22-16-18(17-6-1-3-8-20(17)29-22)23(31)28-10-5-11-30-12-14-32-15-13-30/h1-4,6-9,16H,5,10-15H2,(H,28,31)/p+1 |
| InChIKey | VSHDUEXVDDQQPB-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|