C23H25N3O2 — CID 5074065
2-(3,4-dimethylanilino)-N-(oxolan-2-ylmethyl)quinoline-4-carboxamide (PubChem CID 5074065) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-N-(oxolan-2-ylmethyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethylanilino)-N-(oxolan-2-ylmethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5074065 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 2-(3,4-dimethylanilino)-N-(oxolan-2-ylmethyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C(=O)NCC3CCCO3)c3ccccc3n2)cc1C |
| InChI | InChI=1S/C23H25N3O2/c1-15-9-10-17(12-16(15)2)25-22-13-20(19-7-3-4-8-21(19)26-22)23(27)24-14-18-6-5-11-28-18/h3-4,7-10,12-13,18H,5-6,11,14H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | KKSKMOURSKEMRB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |