C9H8F3O2S- — CID 151925243
2-[4-(trifluoromethyl)thiophen-2-yl]butanoate (PubChem CID 151925243) has the molecular formula C9H8F3O2S- and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)thiophen-2-yl]butanoate.
| Compound Name | 2-[4-(trifluoromethyl)thiophen-2-yl]butanoate |
|---|---|
| PubChem CID | 151925243 |
| Molecular Formula | C9H8F3O2S- |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-[4-(trifluoromethyl)thiophen-2-yl]butanoate |
| SMILES | CCC(C(=O)[O-])c1cc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C9H9F3O2S/c1-2-6(8(13)14)7-3-5(4-15-7)9(10,11)12/h3-4,6H,2H2,1H3,(H,13,14)/p-1 |
| InChIKey | SXPPOFTWSSTPIU-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |