C17H18FN3O3S — CID 151925788
4-[4-[1-(3-fluorophenyl)sulfonylcyclopropyl]pyrimidin-2-yl]morpholine (PubChem CID 151925788) has the molecular formula C17H18FN3O3S and a molecular weight of 363.41 g/mol. Its IUPAC name is 4-[4-[1-(3-fluorophenyl)sulfonylcyclopropyl]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-[1-(3-fluorophenyl)sulfonylcyclopropyl]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 151925788 |
| Molecular Formula | C17H18FN3O3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-[4-[1-(3-fluorophenyl)sulfonylcyclopropyl]pyrimidin-2-yl]morpholine |
| SMILES | O=S(=O)(c1cccc(F)c1)C1(c2ccnc(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C17H18FN3O3S/c18-13-2-1-3-14(12-13)25(22,23)17(5-6-17)15-4-7-19-16(20-15)21-8-10-24-11-9-21/h1-4,7,12H,5-6,8-11H2 |
| InChIKey | SXSNLOBROGQPNC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |