C23H27BF2INO2S — CID 151939417
4-fluoro-N-[3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylcyclopentyl]-2-iodoaniline (PubChem CID 151939417) has the molecular formula C23H27BF2INO2S and a molecular weight of 557.25 g/mol. Its IUPAC name is 4-fluoro-N-[3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylcyclopentyl]-2-iodoaniline.
| Compound Name | 4-fluoro-N-[3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylcyclopentyl]-2-iodoaniline |
|---|---|
| PubChem CID | 151939417 |
| Molecular Formula | C23H27BF2INO2S |
| Molecular Weight | 557.25 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | 4-fluoro-N-[3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylcyclopentyl]-2-iodoaniline |
| SMILES | CC1(C)OB(c2ccc(SC3CCC(Nc4ccc(F)cc4I)C3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C23H27BF2INO2S/c1-22(2)23(3,4)30-24(29-22)14-5-10-21(18(26)11-14)31-17-8-7-16(13-17)28-20-9-6-15(25)12-19(20)27/h5-6,9-12,16-17,28H,7-8,13H2,1-4H3 |
| InChIKey | TUINYEGXIBRVJG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.25 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|