C11H12ClNO5 — CID 151949234
(2S)-2-[(2-chlorobenzoyl)oxy-methylamino]-3-hydroxypropanoic acid (PubChem CID 151949234) has the molecular formula C11H12ClNO5 and a molecular weight of 273.67 g/mol. Its IUPAC name is (2S)-2-[(2-chlorobenzoyl)oxy-methylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(2-chlorobenzoyl)oxy-methylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 151949234 |
| Molecular Formula | C11H12ClNO5 |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (2S)-2-[(2-chlorobenzoyl)oxy-methylamino]-3-hydroxypropanoic acid |
| SMILES | CN(OC(=O)c1ccccc1Cl)[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C11H12ClNO5/c1-13(9(6-14)10(15)16)18-11(17)7-4-2-3-5-8(7)12/h2-5,9,14H,6H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | TWHJUNZZGWYNQM-VIFPVBQESA-N |
| XLogP | 0.79 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|