C12H12ClNO6 — CID 172794810
(2S)-2-[acetyl-(2-chlorobenzoyl)oxyamino]-3-hydroxypropanoic acid (PubChem CID 172794810) has the molecular formula C12H12ClNO6 and a molecular weight of 301.68 g/mol. Its IUPAC name is (2S)-2-[acetyl-(2-chlorobenzoyl)oxyamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[acetyl-(2-chlorobenzoyl)oxyamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 172794810 |
| Molecular Formula | C12H12ClNO6 |
| Molecular Weight | 301.68 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (2S)-2-[acetyl-(2-chlorobenzoyl)oxyamino]-3-hydroxypropanoic acid |
| SMILES | CC(=O)N(OC(=O)c1ccccc1Cl)[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C12H12ClNO6/c1-7(16)14(10(6-15)11(17)18)20-12(19)8-4-2-3-5-9(8)13/h2-5,10,15H,6H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | QBDCUKVYXOFWLS-JTQLQIEISA-N |
| XLogP | 0.71 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.68 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|