C14H13NO12 — CID 151956486
4-(cyanomethyl)cyclohexane-1,1,2,2,3,3-hexacarboxylic acid (PubChem CID 151956486) has the molecular formula C14H13NO12 and a molecular weight of 387.25 g/mol. Its IUPAC name is 4-(cyanomethyl)cyclohexane-1,1,2,2,3,3-hexacarboxylic acid.
| Compound Name | 4-(cyanomethyl)cyclohexane-1,1,2,2,3,3-hexacarboxylic acid |
|---|---|
| PubChem CID | 151956486 |
| Molecular Formula | C14H13NO12 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 4-(cyanomethyl)cyclohexane-1,1,2,2,3,3-hexacarboxylic acid |
| SMILES | N#CCC1CCC(C(=O)O)(C(=O)O)C(C(=O)O)(C(=O)O)C1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H13NO12/c15-4-2-5-1-3-12(6(16)17,7(18)19)14(10(24)25,11(26)27)13(5,8(20)21)9(22)23/h5H,1-3H2,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | TXTAOBTXDYWBAJ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 247.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|