C11H15NO2 — CID 99985590
2-[(3aR,4R,6aS)-3a,6a-dimethyl-2-oxo-3,4,5,6-tetrahydrocyclopenta[b]furan-4-yl]acetonitrile (PubChem CID 99985590) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-[(3aR,4R,6aS)-3a,6a-dimethyl-2-oxo-3,4,5,6-tetrahydrocyclopenta[b]furan-4-yl]acetonitrile.
| Compound Name | 2-[(3aR,4R,6aS)-3a,6a-dimethyl-2-oxo-3,4,5,6-tetrahydrocyclopenta[b]furan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 99985590 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-[(3aR,4R,6aS)-3a,6a-dimethyl-2-oxo-3,4,5,6-tetrahydrocyclopenta[b]furan-4-yl]acetonitrile |
| SMILES | C[C@]12CC[C@H](CC#N)[C@@]1(C)CC(=O)O2 |
| InChI | InChI=1S/C11H15NO2/c1-10-7-9(13)14-11(10,2)5-3-8(10)4-6-12/h8H,3-5,7H2,1-2H3/t8-,10-,11+/m1/s1 |
| InChIKey | KLBKMHMYFNSUAK-IEBDPFPHSA-N |
| XLogP | 2.02 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |