C9H9N5O3 — CID 151967647
1,3-benzoxazole-2,4-dicarbohydrazide (PubChem CID 151967647) has the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. Its IUPAC name is 1,3-benzoxazole-2,4-dicarbohydrazide.
| Compound Name | 1,3-benzoxazole-2,4-dicarbohydrazide |
|---|---|
| PubChem CID | 151967647 |
| Molecular Formula | C9H9N5O3 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1,3-benzoxazole-2,4-dicarbohydrazide |
| SMILES | NNC(=O)c1nc2c(C(=O)NN)cccc2o1 |
| InChI | InChI=1S/C9H9N5O3/c10-13-7(15)4-2-1-3-5-6(4)12-9(17-5)8(16)14-11/h1-3H,10-11H2,(H,13,15)(H,14,16) |
| InChIKey | TZZQNEGXMXSUNK-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|