C12H11NO2 — CID 151968485
1,2,2a,3-tetrahydrobenzo[cd]indole-3-carboxylic acid (PubChem CID 151968485) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1,2,2a,3-tetrahydrobenzo[cd]indole-3-carboxylic acid.
| Compound Name | 1,2,2a,3-tetrahydrobenzo[cd]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 151968485 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1,2,2a,3-tetrahydrobenzo[cd]indole-3-carboxylic acid |
| SMILES | O=C(O)C1C=Cc2cccc3c2C1CN3 |
| InChI | InChI=1S/C12H11NO2/c14-12(15)8-5-4-7-2-1-3-10-11(7)9(8)6-13-10/h1-5,8-9,13H,6H2,(H,14,15) |
| InChIKey | UADYDDMMXNRJJN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |