C20H20N6O6 — CID 151977503
[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-5-yl]-[4-(4-nitrobutoxy)phenyl]methanone (PubChem CID 151977503) has the molecular formula C20H20N6O6 and a molecular weight of 440.42 g/mol. Its IUPAC name is [3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-5-yl]-[4-(4-nitrobutoxy)phenyl]methanone.
| Compound Name | [3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-5-yl]-[4-(4-nitrobutoxy)phenyl]methanone |
|---|---|
| PubChem CID | 151977503 |
| Molecular Formula | C20H20N6O6 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-5-yl]-[4-(4-nitrobutoxy)phenyl]methanone |
| SMILES | NC1(c2nn[nH]n2)COc2cccc(C(=O)c3ccc(OCCCC[N+](=O)[O-])cc3)c2O1 |
| InChI | InChI=1S/C20H20N6O6/c21-20(19-22-24-25-23-19)12-31-16-5-3-4-15(18(16)32-20)17(27)13-6-8-14(9-7-13)30-11-2-1-10-26(28)29/h3-9H,1-2,10-12,21H2,(H,22,23,24,25) |
| InChIKey | UBYVRABQHIIQDL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 168.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|