C25H29N5O4 — CID 150080899
1-[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-5-yl]-3-[2-methyl-4-(4-methylpentoxy)phenyl]prop-2-en-1-one (PubChem CID 150080899) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 1-[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-5-yl]-3-[2-methyl-4-(4-methylpentoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1-[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-5-yl]-3-[2-methyl-4-(4-methylpentoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 150080899 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 1-[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-5-yl]-3-[2-methyl-4-(4-methylpentoxy)phenyl]prop-2-en-1-one |
| SMILES | Cc1cc(OCCCC(C)C)ccc1C=CC(=O)c1cccc2c1OC(N)(c1nn[nH]n1)CO2 |
| InChI | InChI=1S/C25H29N5O4/c1-16(2)6-5-13-32-19-11-9-18(17(3)14-19)10-12-21(31)20-7-4-8-22-23(20)34-25(26,15-33-22)24-27-29-30-28-24/h4,7-12,14,16H,5-6,13,15,26H2,1-3H3,(H,27,28,29,30) |
| InChIKey | DRFZDDFNTOZAAQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|