C24H28N5NaO3 — CID 173345899
sodium;1-[3-amino-7-methyl-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-6-yl]-3-(4-pentylphenyl)prop-2-en-1-one;hydride (PubChem CID 173345899) has the molecular formula C24H28N5NaO3 and a molecular weight of 457.51 g/mol. Its IUPAC name is sodium;1-[3-amino-7-methyl-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-6-yl]-3-(4-pentylphenyl)prop-2-en-1-one;hydride.
| Compound Name | sodium;1-[3-amino-7-methyl-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-6-yl]-3-(4-pentylphenyl)prop-2-en-1-one;hydride |
|---|---|
| PubChem CID | 173345899 |
| Molecular Formula | C24H28N5NaO3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | sodium;1-[3-amino-7-methyl-3-(2H-tetrazol-5-yl)-2H-1,4-benzodioxin-6-yl]-3-(4-pentylphenyl)prop-2-en-1-one;hydride |
| SMILES | CCCCCc1ccc(C=CC(=O)c2cc3c(cc2C)OCC(N)(c2nn[nH]n2)O3)cc1.[H-].[Na+] |
| InChI | InChI=1S/C24H27N5O3.Na.H/c1-3-4-5-6-17-7-9-18(10-8-17)11-12-20(30)19-14-22-21(13-16(19)2)31-15-24(25,32-22)23-26-28-29-27-23;;/h7-14H,3-6,15,25H2,1-2H3,(H,26,27,28,29);;/q;+1;-1 |
| InChIKey | RVQRUZJYDZTGOP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|