C23H25N5OS2 — CID 151335867
1-[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodithiin-5-yl]-3-(4-pentylphenyl)prop-2-en-1-one (PubChem CID 151335867) has the molecular formula C23H25N5OS2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 1-[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodithiin-5-yl]-3-(4-pentylphenyl)prop-2-en-1-one.
| Compound Name | 1-[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodithiin-5-yl]-3-(4-pentylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 151335867 |
| Molecular Formula | C23H25N5OS2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 1-[3-amino-3-(2H-tetrazol-5-yl)-2H-1,4-benzodithiin-5-yl]-3-(4-pentylphenyl)prop-2-en-1-one |
| SMILES | CCCCCc1ccc(C=CC(=O)c2cccc3c2SC(N)(c2nn[nH]n2)CS3)cc1 |
| InChI | InChI=1S/C23H25N5OS2/c1-2-3-4-6-16-9-11-17(12-10-16)13-14-19(29)18-7-5-8-20-21(18)31-23(24,15-30-20)22-25-27-28-26-22/h5,7-14H,2-4,6,15,24H2,1H3,(H,25,26,27,28) |
| InChIKey | OJKWENXDPSMCDI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|