C24H27N5NaO3 — CID 67799088
CID 67799088 (PubChem CID 67799088) has the molecular formula C24H27N5NaO3 and a molecular weight of 456.50 g/mol.
| Compound Name | CID 67799088 |
|---|---|
| PubChem CID | 67799088 |
| Molecular Formula | C24H27N5NaO3 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | — |
| SMILES | CCCCCc1ccc(C=CC(=O)c2cc(C)cc3c2OC(N)(c2nn[nH]n2)CO3)cc1.[Na] |
| InChI | InChI=1S/C24H27N5O3.Na/c1-3-4-5-6-17-7-9-18(10-8-17)11-12-20(30)19-13-16(2)14-21-22(19)32-24(25,15-31-21)23-26-28-29-27-23;/h7-14H,3-6,15,25H2,1-2H3,(H,26,27,28,29); |
| InChIKey | OTSREALHWWIMTJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|