C22H25N5OS — CID 67806254
3-(4-pentylphenyl)-N-[2-(2H-tetrazol-5-ylmethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 67806254) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 3-(4-pentylphenyl)-N-[2-(2H-tetrazol-5-ylmethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | 3-(4-pentylphenyl)-N-[2-(2H-tetrazol-5-ylmethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67806254 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-(4-pentylphenyl)-N-[2-(2H-tetrazol-5-ylmethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | CCCCCc1ccc(C=CC(=O)Nc2ccccc2SCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C22H25N5OS/c1-2-3-4-7-17-10-12-18(13-11-17)14-15-22(28)23-19-8-5-6-9-20(19)29-16-21-24-26-27-25-21/h5-6,8-15H,2-4,7,16H2,1H3,(H,23,28)(H,24,25,26,27) |
| InChIKey | WFVGLPWBRKUGGY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|