C20H24ClN2OS- — CID 71296942
N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide chloride (PubChem CID 71296942) has the molecular formula C20H24ClN2OS- and a molecular weight of 375.95 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide chloride.
| Compound Name | N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide chloride |
|---|---|
| PubChem CID | 71296942 |
| Molecular Formula | C20H24ClN2OS- |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide chloride |
| SMILES | CN(C)CCCSc1ccccc1NC(=O)C=Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H24N2OS.ClH/c1-22(2)15-8-16-24-19-12-7-6-11-18(19)21-20(23)14-13-17-9-4-3-5-10-17;/h3-7,9-14H,8,15-16H2,1-2H3,(H,21,23);1H/p-1 |
| InChIKey | LXGJPDKYMJJWRB-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|