C20H27ClN2O2S — CID 23581800
(E)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide;hydrate;hydrochloride (PubChem CID 23581800) has the molecular formula C20H27ClN2O2S and a molecular weight of 394.97 g/mol. Its IUPAC name is (E)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide;hydrate;hydrochloride.
| Compound Name | (E)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 23581800 |
| Molecular Formula | C20H27ClN2O2S |
| Molecular Weight | 394.97 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (E)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide;hydrate;hydrochloride |
| SMILES | CN(C)CCCSc1ccccc1NC(=O)/C=C/c1ccccc1.Cl.O |
| InChI | InChI=1S/C20H24N2OS.ClH.H2O/c1-22(2)15-8-16-24-19-12-7-6-11-18(19)21-20(23)14-13-17-9-4-3-5-10-17;;/h3-7,9-14H,8,15-16H2,1-2H3,(H,21,23);1H;1H2/b14-13+;; |
| InChIKey | BGDSAZGUWPTUHZ-QDBORUFSSA-N |
| XLogP | 3.98 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.97 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|