C20H23ClN2OS — CID 6441423
(E)-3-(2-chlorophenyl)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]prop-2-enamide (PubChem CID 6441423) has the molecular formula C20H23ClN2OS and a molecular weight of 374.94 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6441423 |
| Molecular Formula | C20H23ClN2OS |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]prop-2-enamide |
| SMILES | CN(C)CCCSc1ccccc1NC(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C20H23ClN2OS/c1-23(2)14-7-15-25-19-11-6-5-10-18(19)22-20(24)13-12-16-8-3-4-9-17(16)21/h3-6,8-13H,7,14-15H2,1-2H3,(H,22,24)/b13-12+ |
| InChIKey | MWSQFEYXLRVZAC-OUKQBFOZSA-N |
| XLogP | 5.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|