C25H31NO3S — CID 19378696
4-[2-[[(E)-3-(3-methyl-4-pentylphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoic acid (PubChem CID 19378696) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is 4-[2-[[(E)-3-(3-methyl-4-pentylphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoic acid.
| Compound Name | 4-[2-[[(E)-3-(3-methyl-4-pentylphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 19378696 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 4-[2-[[(E)-3-(3-methyl-4-pentylphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoic acid |
| SMILES | CCCCCc1ccc(/C=C/C(=O)Nc2ccccc2SCCCC(=O)O)cc1C |
| InChI | InChI=1S/C25H31NO3S/c1-3-4-5-9-21-15-13-20(18-19(21)2)14-16-24(27)26-22-10-6-7-11-23(22)30-17-8-12-25(28)29/h6-7,10-11,13-16,18H,3-5,8-9,12,17H2,1-2H3,(H,26,27)(H,28,29)/b16-14+ |
| InChIKey | XLHUVPNDJGRYIS-JQIJEIRASA-N |
| XLogP | 6.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|