C5H8N4O — CID 15209666
N-[(5-methyl-1H-pyrazol-3-yl)amino]formamide (PubChem CID 15209666) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is N-[(5-methyl-1H-pyrazol-3-yl)amino]formamide.
| Compound Name | N-[(5-methyl-1H-pyrazol-3-yl)amino]formamide |
|---|---|
| PubChem CID | 15209666 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | N-[(5-methyl-1H-pyrazol-3-yl)amino]formamide |
| SMILES | Cc1cc(NNC=O)n[nH]1 |
| InChI | InChI=1S/C5H8N4O/c1-4-2-5(9-7-4)8-6-3-10/h2-3H,1H3,(H,6,10)(H2,7,8,9) |
| InChIKey | LNIGWFXJYDQGCW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|