C26H44O3 — CID 15211975
5,5-dimethyl-2-[(Z)-octadec-9-enoyl]cyclohexane-1,3-dione (PubChem CID 15211975) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(Z)-octadec-9-enoyl]cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-[(Z)-octadec-9-enoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 15211975 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 5,5-dimethyl-2-[(Z)-octadec-9-enoyl]cyclohexane-1,3-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C26H44O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(27)25-23(28)20-26(2,3)21-24(25)29/h11-12,25H,4-10,13-21H2,1-3H3/b12-11- |
| InChIKey | OJOKGGKXUAEUDL-QXMHVHEDSA-N |
| XLogP | 7.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|