C9H11NO — CID 15213206
N-ethylcyclohepta-2,4,6-trien-1-imine oxide (PubChem CID 15213206) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is N-ethylcyclohepta-2,4,6-trien-1-imine oxide.
| Compound Name | N-ethylcyclohepta-2,4,6-trien-1-imine oxide |
|---|---|
| PubChem CID | 15213206 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | N-ethylcyclohepta-2,4,6-trien-1-imine oxide |
| SMILES | CC[N+]([O-])=c1cccccc1 |
| InChI | InChI=1S/C9H11NO/c1-2-10(11)9-7-5-3-4-6-8-9/h3-8H,2H2,1H3 |
| InChIKey | OVHLGKQIVMCBGP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|