About diethylalumanylium;nitrobenzene;chloride
diethylalumanylium;nitrobenzene;chloride (PubChem CID 174800840) has the molecular formula C10H15AlClNO2
and a molecular weight of 243.67 g/mol. Its IUPAC name is diethylalumanylium;nitrobenzene;chloride.
Molecular Properties
| Compound Name | diethylalumanylium;nitrobenzene;chloride |
| PubChem CID | 174800840 |
| Molecular Formula | C10H15AlClNO2 |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | diethylalumanylium;nitrobenzene;chloride |
| SMILES | CC[Al+]CC.O=[N+]([O-])c1ccccc1.[Cl-] |
| InChI | InChI=1S/C6H5NO2.2C2H5.Al.ClH/c8-7(9)6-4-2-1-3-5-6;2*1-2;;/h1-5H;2*1H2,2H3;;1H/q;;;+1;/p-1 |
| InChIKey | RBNJCKASFXEHCN-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethylalumanylium;nitrobenzene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylalumanylium;nitrobenzene;chloride?
The IUPAC name of diethylalumanylium;nitrobenzene;chloride (CID 174800840) is diethylalumanylium;nitrobenzene;chloride.
What is the SMILES notation for diethylalumanylium;nitrobenzene;chloride?
The canonical SMILES for diethylalumanylium;nitrobenzene;chloride is CC[Al+]CC.O=[N+]([O-])c1ccccc1.[Cl-].
What is the InChIKey of diethylalumanylium;nitrobenzene;chloride?
The InChIKey is RBNJCKASFXEHCN-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2.2C2H5.Al.ClH/c8-7(9)6-4-2-1-3-5-6;2*1-2;;/h1-5H;2*1H2,2H3;;1H/q;;;+1;/p-1.
What are the key properties of diethylalumanylium;nitrobenzene;chloride?
diethylalumanylium;nitrobenzene;chloride has a molecular weight of 243.67 g/mol, XLogP of 0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethylalumanylium;nitrobenzene;chloride is sourced from PubChem (CID 174800840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).