C20H28N4O5S — CID 15222318
2-[[1-[1-(ethylamino)-1-oxooctan-2-yl]imidazol-4-yl]carbamoyl]benzenesulfonic acid (PubChem CID 15222318) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-[[1-[1-(ethylamino)-1-oxooctan-2-yl]imidazol-4-yl]carbamoyl]benzenesulfonic acid.
| Compound Name | 2-[[1-[1-(ethylamino)-1-oxooctan-2-yl]imidazol-4-yl]carbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 15222318 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[[1-[1-(ethylamino)-1-oxooctan-2-yl]imidazol-4-yl]carbamoyl]benzenesulfonic acid |
| SMILES | CCCCCCC(C(=O)NCC)n1cnc(NC(=O)c2ccccc2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H28N4O5S/c1-3-5-6-7-11-16(20(26)21-4-2)24-13-18(22-14-24)23-19(25)15-10-8-9-12-17(15)30(27,28)29/h8-10,12-14,16H,3-7,11H2,1-2H3,(H,21,26)(H,23,25)(H,27,28,29) |
| InChIKey | MXQMJMFJGPLXGD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|